methoxytriphenylsilane
Modify Date: 2025-08-20 11:53:37
methoxytriphenylsilane structure
|
Common Name | methoxytriphenylsilane | ||
|---|---|---|---|---|
| CAS Number | 1829-41-0 | Molecular Weight | 290.43100 | |
| Density | 1.08g/cm3 | Boiling Point | 327.9ºC at 760 mmHg | |
| Molecular Formula | C19H18OSi | Melting Point | 57 °C | |
| MSDS | N/A | Flash Point | 152.6ºC | |
| Name | methoxy(triphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 327.9ºC at 760 mmHg |
| Melting Point | 57 °C |
| Molecular Formula | C19H18OSi |
| Molecular Weight | 290.43100 |
| Flash Point | 152.6ºC |
| Exact Mass | 290.11300 |
| PSA | 9.23000 |
| LogP | 2.29990 |
| Vapour Pressure | 0.000376mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | BKXVGDZNDSIUAI-UHFFFAOYSA-N |
| SMILES | CO[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| methyl triphenylsilyl ether |
| Methoxytriphenylsilane |
| EINECS 217-382-1 |
| Methoxytriphenylsilan |
| Silane,methoxytriphenyl |