MG 1
Modify Date: 2025-08-21 12:23:04
MG 1 structure
|
Common Name | MG 1 | ||
|---|---|---|---|---|
| CAS Number | 148274-76-4 | Molecular Weight | 303.39900 | |
| Density | 1.18g/cm3 | Boiling Point | 529.5ºC at 760mmHg | |
| Molecular Formula | C17H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274ºC | |
Use of MG 1MG 1 is an α1 adrenergic receptor antagonist. |
| Name | 1-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]pyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | MG 1 is an α1 adrenergic receptor antagonist. |
|---|---|
| Related Catalog | |
| Target |
Adrenergic receptor[1] |
| In Vitro | Refer to the compound 23[1]. |
| References |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 529.5ºC at 760mmHg |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.39900 |
| Flash Point | 274ºC |
| Exact Mass | 303.19500 |
| PSA | 47.02000 |
| LogP | 0.73270 |
| Vapour Pressure | 4.86E-12mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | AFBKGQPVUQUMRC-UHFFFAOYSA-N |
| SMILES | O=C1CCCN1CC(O)CN1CCN(c2ccccc2)CC1 |
| Storage condition | 2-8℃ |
| 2-Pyrrolidinone,1-(2-hydroxy-3-(4-phenyl-1-piperazinyl)propyl) |
| MG-1 |
| 1-[2-hydroxy-3-(4-phenyl-1-piperazinyl)propyl]pyrrolidin-2-one |
| 1-(2-Hydroxy-3-(4-phenyl-1-piperazinyl)propyl)-2-pyrrolidinone |
| MG 1 |