Pamiparib structure
|
Common Name | Pamiparib | ||
|---|---|---|---|---|
| CAS Number | 1446261-44-4 | Molecular Weight | 298.315 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15FN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PamiparibPamiparib is a PARP inhibitor which can be used for the treatment of various cancers including the solid tumor, extracted from patent WO 2013097225 A1. |
| Name | Pamiparib |
|---|---|
| Synonym | More Synonyms |
| Description | Pamiparib is a PARP inhibitor which can be used for the treatment of various cancers including the solid tumor, extracted from patent WO 2013097225 A1. |
|---|---|
| Related Catalog | |
| Target |
PARP |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H15FN4O |
| Molecular Weight | 298.315 |
| Exact Mass | 298.122986 |
| LogP | 0.02 |
| Index of Refraction | 1.829 |
| InChIKey | DENYZIUJOTUUNY-MRXNPFEDSA-N |
| SMILES | CC12CCCN1CC1=NNC(=O)c3cc(F)cc4[nH]c2c1c34 |
| Storage condition | -20℃ |
| (10aR)-2-Fluoro-10a-methyl-5,8,9,10,10a,11-hexahydro-5,6,7a,11-tetraazacyclohepta[1,2,3,4-def]cyclopenta[a]fluoren-4(7H)-one |
| pamiparib |
| 5,6,7a,11-Tetraazacyclohepta[def]cyclopenta[a]fluoren-4(7H)-one, 2-fluoro-5,8,9,10,10a,11-hexahydro-10a-methyl-, (10aR)- |
| 8375F9S90C |