(R)-1-Boc-3-Hydroxypiperidine structure
|
Common Name | (R)-1-Boc-3-Hydroxypiperidine | ||
|---|---|---|---|---|
| CAS Number | 143900-43-0 | Molecular Weight | 201.26 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 292.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO3 | Melting Point | 43-50ºC | |
| MSDS | Chinese USA | Flash Point | 130.6±25.4 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
Use of (R)-1-Boc-3-Hydroxypiperidine(R)-1-Boc-3-Hydroxypiperidine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | (R)-1-Boc-3-Hydroxypiperidine |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-1-Boc-3-Hydroxypiperidine is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.3±33.0 °C at 760 mmHg |
| Melting Point | 43-50ºC |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.26 |
| Flash Point | 130.6±25.4 °C |
| Exact Mass | 201.136490 |
| PSA | 49.77000 |
| LogP | 0.49 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | UIJXHKXIOCDSEB-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)C1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H318-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S45-S36-S37-S39 |
| RIDADR | UN 2811 6.1/PG 3 |
| Hazard Class | 6.1 |
|
~98%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: Tetrahedron, , vol. 67, # 7 p. 1485 - 1500 |
|
~96%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 44, # 1 p. 31 - 41 |
|
~%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: US5300515 A1, ; |
|
~%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: EP1320525 B1, ; |
|
~%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: Tetrahedron, , vol. 67, # 7 p. 1485 - 1500 |
|
~%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: Tetrahedron, , vol. 67, # 7 p. 1485 - 1500 |
|
~%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: Tetrahedron, , vol. 67, # 7 p. 1485 - 1500 |
|
~%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: Tetrahedron, , vol. 67, # 7 p. 1485 - 1500 |
|
~%
(R)-1-Boc-3-Hyd... CAS#:143900-43-0 |
| Literature: Tetrahedron, , vol. 67, # 7 p. 1485 - 1500 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| R-1-Boc-3-hydroxypiperidine |
| tert-butyl (3R)-3-hydroxypiperidine-1-carboxylate |
| 1-Piperidinecarboxylic acid, 3-hydroxy-, 1,1-dimethylethyl ester, (3R)- |
| MFCD06659042 |
| 2-Methyl-2-propanyl 3-hydroxy-1-piperidinecarboxylate |
| (R)-1-Boc-3-hydroxypiperidine |
| tert-Butyl-(3R)-3-hydroxypiperidin-1-carboxylat |
| (R)-1-(tert-Butoxycarbonyl)-3-hydroxypiperidine |
| 2-Methyl-2-propanyl (3R)-3-hydroxy-1-piperidinecarboxylate |
| (R)-1-Boc-3-piperidinol |