1-Boc-3-hydroxypiperidine structure
|
Common Name | 1-Boc-3-hydroxypiperidine | ||
|---|---|---|---|---|
| CAS Number | 85275-45-2 | Molecular Weight | 201.263 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 292.3±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO3 | Melting Point | 65-67°C | |
| MSDS | Chinese USA | Flash Point | 130.6±25.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Boc-3-hydroxypiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 292.3±33.0 °C at 760 mmHg |
| Melting Point | 65-67°C |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.263 |
| Flash Point | 130.6±25.4 °C |
| Exact Mass | 201.136490 |
| PSA | 49.77000 |
| LogP | 0.49 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | UIJXHKXIOCDSEB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)C1 |
| Storage condition | Store at -15°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~99%
1-Boc-3-hydroxy... CAS#:85275-45-2 |
| Literature: Audouze, Karine; Nielsen, Elsebet stergaard; Olsen, Gunnar M.; Ahring, Philip; Jorgensen, Tino Dyhring; Peters, Dan; Liljefors, Tommy; Balle, Thomas Journal of Medicinal Chemistry, 2006 , vol. 49, # 11 p. 3159 - 3171 |
|
~91%
1-Boc-3-hydroxy... CAS#:85275-45-2 |
| Literature: LG LIFE SCIENCES, LTD. Patent: WO2009/82134 A2, 2009 ; Location in patent: Page/Page column 36-37 ; WO 2009/082134 A2 |
|
~85%
1-Boc-3-hydroxy... CAS#:85275-45-2 |
| Literature: Sumitomo Pharmaceuticals Company, Limited Patent: EP1403255 A1, 2004 ; Location in patent: Page 93 ; EP 1403255 A1 |
|
~%
1-Boc-3-hydroxy... CAS#:85275-45-2 |
| Literature: US4435405 A1, ; |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02093938 |
| tert-butyl 3-hydroxypiperidine-1-carboxylate |
| 2-Methyl-2-propanyl 3-hydroxy-1-piperidinecarboxylate |
| N-BOC-3-hydroxypiperidine |