1-Boc-3-Piperidinone structure
|
Common Name | 1-Boc-3-Piperidinone | ||
|---|---|---|---|---|
| CAS Number | 98977-36-7 | Molecular Weight | 199.25 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 289.8±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO3 | Melting Point | 35-40 °C(lit.) | |
| MSDS | N/A | Flash Point | 129.1±25.4 °C | |
Use of 1-Boc-3-Piperidinone1-Boc-3-piperidone is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 1-Boc-3-piperidone |
|---|---|
| Synonym | More Synonyms |
| Description | 1-Boc-3-piperidone is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.8±33.0 °C at 760 mmHg |
| Melting Point | 35-40 °C(lit.) |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 |
| Flash Point | 129.1±25.4 °C |
| Exact Mass | 199.120850 |
| PSA | 46.61000 |
| LogP | 0.41 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | RIFXIGDBUBXKEI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=O)C1 |
| Storage condition | Store at?0-5°C |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 3-Oxopiperidine-1-carboxylate |
| tert-Butyl-3-oxopiperidin-1-carboxylat |
| MFCD01631193 |
| 1-Boc-3-piperidone |
| 2-Methyl-2-propanyl 3-oxo-1-piperidinecarboxylate |
| 1-Piperidinecarboxylic acid, 3-oxo-, 1,1-dimethylethyl ester |
| N-Boc-3-piperidone |