SGK1-IN-2 structure
|
Common Name | SGK1-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 1426214-64-3 | Molecular Weight | 435.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12Cl2N6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SGK1-IN-2SGK1-IN-2 (14h) is a selective SGK1 (serum and glucocorticoid regulated kinase 1) inhibitor, with an IC50 of 5 nM at 10 μM ATP concentration[1]. |
| Name | SGK1-IN-2 |
|---|
| Description | SGK1-IN-2 (14h) is a selective SGK1 (serum and glucocorticoid regulated kinase 1) inhibitor, with an IC50 of 5 nM at 10 μM ATP concentration[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H12Cl2N6O2S |
|---|---|
| Molecular Weight | 435.29 |
| InChIKey | RTERCHJCWXQPSS-UHFFFAOYSA-N |
| SMILES | Nc1[nH]nc2nc(-c3ccc(NS(=O)(=O)c4cc(Cl)ccc4Cl)cc3)cnc12 |