Azide-PEG5-Boc
Modify Date: 2025-08-20 16:56:11
Azide-PEG5-Boc structure
|
Common Name | Azide-PEG5-Boc | ||
|---|---|---|---|---|
| CAS Number | 1415800-41-7 | Molecular Weight | 391.460 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H33N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azide-PEG5-BocAzide-PEG5-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azide-PEG5-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Azide-PEG5-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C17H33N3O7 |
|---|---|
| Molecular Weight | 391.460 |
| Exact Mass | 391.231842 |
| LogP | 0.27 |
| InChIKey | RGXALMUKZGZJKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| 2-Methyl-2-propanyl 1-azido-3,6,9,12,15-pentaoxaoctadecan-18-oate |
| 3,6,9,12,15-Pentaoxaoctadecan-18-oic acid, 1-azido-, 1,1-dimethylethyl ester |
| MFCD22683303 |