Mc-MMAD structure
|
Common Name | Mc-MMAD | ||
|---|---|---|---|---|
| CAS Number | 1401963-15-2 | Molecular Weight | 964.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C51H77N7O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mc-MMADMonomethyl auristatin D (MMAD), a potent tubulin inhibitor, is a toxin payload in antibody drug conjugate; Mc-MMAD is a protective group (maleimidocaproyl) -conjugated MMAD.IC50 Value:Target: tubulin; ADCsFor comparison purposes, the ADC A1 -mc-MMAD and/or A1 -vc-MMAD were used. The linker payload, mc-MMAD (6-maleimidocaproyl-monomethylauristatin-D) was conjugated to the A1 anti-5T4 monoclonal antibody through a cysteine residue at a ratio of approximately 4 drug moieties per antibody molecule. The linker payload mc- Val-Cit-PABA-MMAD or vc-MMAD (maleimidocapronic -valine-citruline-p- aminobenzyloxycarbonyl- monomethylauristatin-D) was conjugated to the A1 anti-5T4 monoclonal antibody through a cysteine residue at a ratio of approximately 4 drug moieties per antibody molecule (Antibody-drug conjugates Patent: WO 2013068874 A1). |
| Name | Mc-MMAD |
|---|
| Description | Monomethyl auristatin D (MMAD), a potent tubulin inhibitor, is a toxin payload in antibody drug conjugate; Mc-MMAD is a protective group (maleimidocaproyl) -conjugated MMAD.IC50 Value:Target: tubulin; ADCsFor comparison purposes, the ADC A1 -mc-MMAD and/or A1 -vc-MMAD were used. The linker payload, mc-MMAD (6-maleimidocaproyl-monomethylauristatin-D) was conjugated to the A1 anti-5T4 monoclonal antibody through a cysteine residue at a ratio of approximately 4 drug moieties per antibody molecule. The linker payload mc- Val-Cit-PABA-MMAD or vc-MMAD (maleimidocapronic -valine-citruline-p- aminobenzyloxycarbonyl- monomethylauristatin-D) was conjugated to the A1 anti-5T4 monoclonal antibody through a cysteine residue at a ratio of approximately 4 drug moieties per antibody molecule (Antibody-drug conjugates Patent: WO 2013068874 A1). |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C51H77N7O9S |
|---|---|
| Molecular Weight | 964.26 |
| InChIKey | OZUQLKHIIRUJRZ-ZGLOPKFWSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(Cc1ccccc1)c1nccs1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| Storage condition | 2-8℃ |