MC-SN38 structure
|
Common Name | MC-SN38 | ||
|---|---|---|---|---|
| CAS Number | 1473403-87-0 | Molecular Weight | 585.60 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H31N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MC-SN38MC-SN38 is a drug-linker conjugate composed of a potent microtubule-disrupting agent SN38 and a non-cleavable MC linker to make antibody drug conjugate (ADC). SN-38, an active metabolite of the Topoisomerase I inhibitor Irinotecan, inhibits DNA synthesis and causes frequent DNA single-strand breaks[1][2]. |
| Name | MC-SN38 |
|---|
| Description | MC-SN38 is a drug-linker conjugate composed of a potent microtubule-disrupting agent SN38 and a non-cleavable MC linker to make antibody drug conjugate (ADC). SN-38, an active metabolite of the Topoisomerase I inhibitor Irinotecan, inhibits DNA synthesis and causes frequent DNA single-strand breaks[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H31N3O8 |
|---|---|
| Molecular Weight | 585.60 |
| InChIKey | ACRMADURFCYBAU-YTTGMZPUSA-N |
| SMILES | CCc1c2c(nc3ccc(O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(CC)OC(=O)CCCCCN1C(=O)C=CC1=O |
| Hazard Codes | Xi |
|---|