Chloroacetamido-PEG4-NHS ester
Modify Date: 2025-08-26 19:00:10
Chloroacetamido-PEG4-NHS ester structure
|
Common Name | Chloroacetamido-PEG4-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1353011-95-6 | Molecular Weight | 438.857 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H27ClN2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Chloroacetamido-PEG4-NHS esterChloroacetamido-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Chloroacetamido-PEG4-NHS ester |
|---|---|
| Synonym | More Synonyms |
| Description | Chloroacetamido-PEG4-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C17H27ClN2O9 |
| Molecular Weight | 438.857 |
| Exact Mass | 438.140503 |
| LogP | -3.45 |
| Index of Refraction | 1.513 |
| InChIKey | BPWFCYSNJLMFRO-UHFFFAOYSA-N |
| SMILES | O=C(CCl)NCCOCCOCCOCCOCCC(=O)ON1C(=O)CCC1=O |
| 2-Chloro-N-{15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl}acetamide |
| Acetamide, 2-chloro-N-[15-[(2,5-dioxo-1-pyrrolidinyl)oxy]-15-oxo-3,6,9,12-tetraoxapentadec-1-yl]- |