Atorvastatin Sodium structure
|
Common Name | Atorvastatin Sodium | ||
|---|---|---|---|---|
| CAS Number | 134523-01-6 | Molecular Weight | 580.62 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 722.2±60.0ºC at 760 mmHg | |
| Molecular Formula | C33H34FN2NaO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 390.6±32.9ºC | |
Use of Atorvastatin SodiumAtorvastatin sodium is an orally active HMG-CoA reductase inhibitor, has the ability to effectively decrease blood lipids. Atorvastatin sodium inhibits human SV-SMC proliferation and invasion with IC50s of 0.39 μM and 2.39 μM, respectively[1][2][3][4][5]. |
| Name | atorvastatin sodium |
|---|---|
| Synonym | More Synonyms |
| Description | Atorvastatin sodium is an orally active HMG-CoA reductase inhibitor, has the ability to effectively decrease blood lipids. Atorvastatin sodium inhibits human SV-SMC proliferation and invasion with IC50s of 0.39 μM and 2.39 μM, respectively[1][2][3][4][5]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 722.2±60.0ºC at 760 mmHg |
| Molecular Formula | C33H34FN2NaO5 |
| Molecular Weight | 580.62 |
| Flash Point | 390.6±32.9ºC |
| Exact Mass | 580.234924 |
| PSA | 114.62000 |
| LogP | 5.05190 |
| InChIKey | VVRPOCPLIUDBSA-CNZCJKERSA-M |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)[O-].[Na+] |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| 1H-Pyrrole-1-heptanoic acid, 2-(4-fluorophenyl)-β,δ-dihydroxy-5-(1-methylethyl)-3-phenyl-4-[(phenylamino)carbonyl]-, sodium salt, (βR,δR)- (1:1) |
| Atorvastatin Sodium |
| Sodium (3R,5R)-7-[2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl]-3,5-dihydroxyheptanoate |
| atorvastatin sodium salt |
| 3R,5R-Atorvastaatin Sodium salt |