Atorvastatin Ethyl Ester
Modify Date: 2025-08-26 10:14:37
Atorvastatin Ethyl Ester structure
|
Common Name | Atorvastatin Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 1146977-93-6 | Molecular Weight | 586.69300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H39FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Atorvastatin Ethyl EsterAtorvastatin ethyl ester is a derivative of Atorvastatin and displays strong inhibition of the 9-cis-RA-induced Gal4 reporter activity[1]. |
| Name | (3R,5R)-ethyl 7-(2-(4-fluorophenyl)-5-isopropyl-3-phenyl-4-phenylcarbamoyl-1H-pyrrol-1-yl)-3,5-dihydroxyheptanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Atorvastatin ethyl ester is a derivative of Atorvastatin and displays strong inhibition of the 9-cis-RA-induced Gal4 reporter activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C35H39FN2O5 |
|---|---|
| Molecular Weight | 586.69300 |
| Exact Mass | 586.28400 |
| PSA | 100.79000 |
| LogP | 6.86510 |
| InChIKey | CXXBPVDOSCOVJU-FQLXRVMXSA-N |
| SMILES | CCOC(=O)CC(O)CC(O)CCn1c(-c2ccc(F)cc2)c(-c2ccccc2)c(C(=O)Nc2ccccc2)c1C(C)C |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:134523-00-5
CAS#:134523-01-6| Atorvastatin Acid Ethyl Ester |
| Atorvastatin Ethyl Ester |
| Atorvastatin Impurity 4 |