Tazomeline
Modify Date: 2025-08-25 13:05:17
Tazomeline structure
|
Common Name | Tazomeline | ||
|---|---|---|---|---|
| CAS Number | 131987-54-7 | Molecular Weight | 297.48300 | |
| Density | 1.15g/cm3 | Boiling Point | 407.8ºC at 760mmHg | |
| Molecular Formula | C14H23N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.4ºC | |
Use of TazomelineTazomeline is a selective M1 muscarinic receptor agonist. Tazomeline inhibits twitch height in rabbit vas deferens(IC50= 0.001 nM). Tazomeline can be used for research of neuropsychiatric disorders[1]. |
| Name | 3-hexylsulfanyl-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole |
|---|---|
| Synonym | More Synonyms |
| Description | Tazomeline is a selective M1 muscarinic receptor agonist. Tazomeline inhibits twitch height in rabbit vas deferens(IC50= 0.001 nM). Tazomeline can be used for research of neuropsychiatric disorders[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 407.8ºC at 760mmHg |
| Molecular Formula | C14H23N3S2 |
| Molecular Weight | 297.48300 |
| Flash Point | 200.4ºC |
| Exact Mass | 297.13300 |
| PSA | 82.56000 |
| LogP | 3.86730 |
| Vapour Pressure | 7.36E-07mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | XUHMGFKQBWZWPO-UHFFFAOYSA-N |
| SMILES | CCCCCCSc1nsnc1C1=CCCN(C)C1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
CAS#:131988-61-9| Tazomeline [INN] |
| (3-Hexylthio)-tztp |
| UNII-QDP6S14W5W |
| Tazomeline |
| 3-(3-Hexylthio-1,2,5-thiadiazol-4-yl)-1,2,5,6-tetrahydro-1-methylpyridine |
| 3-(4-hexylthio-1,2,5-thiadiazol-3-yl)-1,2,5,6-tetrahydro-1-methylpyridine |