2-Hydroxy Atorvastatin-d5 disodium structure
|
Common Name | 2-Hydroxy Atorvastatin-d5 disodium | ||
|---|---|---|---|---|
| CAS Number | 1276537-19-9 | Molecular Weight | 623.63400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H28D5FN2Na2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-Hydroxy Atorvastatin-d5 disodium2-Hydroxy Atorvastatin-d5 (disodium) is the deuterium labeled 2-Hydroxy Atorvastatin disodium[1]. |
| Name | 2-Hydroxy Atorvastatin-d5 Disodium Salt |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Hydroxy Atorvastatin-d5 (disodium) is the deuterium labeled 2-Hydroxy Atorvastatin disodium[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C33H28D5FN2Na2O6 |
|---|---|
| Molecular Weight | 623.63400 |
| Exact Mass | 623.24300 |
| PSA | 141.17000 |
| LogP | 5.50670 |
| InChIKey | KNVKONHBFPQVPI-SZNAXHTISA-L |
| SMILES | CC(C)c1c(C(=O)Nc2ccccc2[O-])c(-c2ccccc2)c(-c2ccc(F)cc2)n1CCC(O)CC(O)CC(=O)[O-].[Na+].[Na+] |
| disodium,(3R,5R)-7-[2-(4-fluorophenyl)-4-[(2-oxidophenyl)carbamoyl]-3-(2,3,4,5,6-pentadeuteriophenyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate |