Acamprosate-d3 (calcium salt) structure
|
Common Name | Acamprosate-d3 (calcium salt) | ||
|---|---|---|---|---|
| CAS Number | 1225580-94-8 | Molecular Weight | 223.29900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7CaD3NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Acamprosate-d3 (calcium salt)Acamprosate D3 calcium is the deuterium labeled Acamprosate calcium. Acamprosate calcium is a GABA receptor agonist and modulator of glutamatergic systems[1][2]. |
| Name | calcium,3-[(2,2,2-trideuterioacetyl)amino]propane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Acamprosate D3 calcium is the deuterium labeled Acamprosate calcium. Acamprosate calcium is a GABA receptor agonist and modulator of glutamatergic systems[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C5H7CaD3NO4S |
|---|---|
| Molecular Weight | 223.29900 |
| Exact Mass | 223.01400 |
| PSA | 98.17000 |
| LogP | 1.19400 |
| InChIKey | WPEXQWVYZZXPJW-NIIDSAIPSA-M |
| SMILES | CC(=O)NCCCS(=O)(=O)[O-].[Ca+2] |
| Storage condition | 2-8°C |
| [2H3]-Acamprosate calcium salt |
| 1-Propanesulfonic acid,3-(acetyl-2,2,2-d3-amino)-,calcium salt (2:1) |