4'-Bromo-resveratrol structure
|
Common Name | 4'-Bromo-resveratrol | ||
|---|---|---|---|---|
| CAS Number | 1224713-90-9 | Molecular Weight | 291.14000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11BrO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 4'-Bromo-resveratrol4'-Bromo-resveratrol is a potent and dual inhibitor Sirtuin-1 and Sirtuin-3. 4'-Bromo-resveratrol inhibits melanoma cell growth through mitochondrial metabolic reprogramming. 4'-Bromo-resveratrol imparts antiproliferative effects in melanoma cells through a metabolic reprogramming and affecting the cell cycle and apoptosis signaling[1]. |
| Name | 5-[(E)-2-(4-bromophenyl)ethenyl]benzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Description | 4'-Bromo-resveratrol is a potent and dual inhibitor Sirtuin-1 and Sirtuin-3. 4'-Bromo-resveratrol inhibits melanoma cell growth through mitochondrial metabolic reprogramming. 4'-Bromo-resveratrol imparts antiproliferative effects in melanoma cells through a metabolic reprogramming and affecting the cell cycle and apoptosis signaling[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H11BrO2 |
|---|---|
| Molecular Weight | 291.14000 |
| Exact Mass | 289.99400 |
| PSA | 40.46000 |
| LogP | 4.03070 |
| InChIKey | NCJVLKFAQIWASE-OWOJBTEDSA-N |
| SMILES | Oc1cc(O)cc(C=Cc2ccc(Br)cc2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| 4-Bromo-Resveratrol |