Cholesteryl caprylate structure
|
Common Name | Cholesteryl caprylate | ||
|---|---|---|---|---|
| CAS Number | 1182-42-9 | Molecular Weight | 512.85000 | |
| Density | 0.97 g/cm3 | Boiling Point | 565ºC at 760 mmHg | |
| Molecular Formula | C35H60O2 | Melting Point | 110 °C(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cholesteryl caprylateCholesterol n-Octanoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Cholesterol n-Octanoate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 0.97 g/cm3 |
|---|---|
| Boiling Point | 565ºC at 760 mmHg |
| Melting Point | 110 °C(lit.) |
| Molecular Formula | C35H60O2 |
| Molecular Weight | 512.85000 |
| Exact Mass | 512.45900 |
| PSA | 26.30000 |
| LogP | 10.30010 |
| Vapour Pressure | 8.69E-13mmHg at 25°C |
| Index of Refraction | 1.51 |
| InChIKey | SKLBBRQPVZDTNM-SJTWHRLHSA-N |
| SMILES | CCCCCCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| Safety Phrases | S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
Cholesteryl cap... CAS#:1182-42-9 |
| Literature: Z. Krebsf., , vol. 48, p. 366 |
|
~95%
Cholesteryl cap... CAS#:1182-42-9 |
| Literature: Komura, Kenichi; Ozaki, Akiyoshi; Ieda, Noboru; Sugi, Yoshihiro Synthesis, 2008 , # 21 art. no. F11308SS, p. 3407 - 3410 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| cholesterol octanoate |
| Cholesterol Caprylate |
| EINECS 214-656-2 |
| 3beta-Hydroxy-5-cholestene 3-octanoate |
| cholesterol caprilate |
| Cholesteryl caprylate |
| Cholesteryl n-octanoate |
| cholesteryl octanoate |
| Cholesterol n-Octanoate |
| MFCD00003642 |