Sodium Taurodeoxycholate structure
|
Common Name | Sodium Taurodeoxycholate | ||
|---|---|---|---|---|
| CAS Number | 1180-95-6 | Molecular Weight | 521.685 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H44NNaO6S | Melting Point | 168 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sodium TaurodeoxycholateTaurodeoxycholate sodium salt is a bile salt-related anionic detergent used for isolation of membrane proteins including inner mitochondrial membrane proteins. Taurodeoxycholate (TDCA) inhibits various inflammatory responses[1] [2][3]. |
| Name | Taurodeoxycholic acid sodium salt hydrate |
|---|---|
| Synonym | More Synonyms |
| Description | Taurodeoxycholate sodium salt is a bile salt-related anionic detergent used for isolation of membrane proteins including inner mitochondrial membrane proteins. Taurodeoxycholate (TDCA) inhibits various inflammatory responses[1] [2][3]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 168 °C (dec.)(lit.) |
|---|---|
| Molecular Formula | C26H44NNaO6S |
| Molecular Weight | 521.685 |
| Exact Mass | 521.278687 |
| PSA | 135.14000 |
| LogP | 4.52640 |
| InChIKey | YXHRQQJFKOHLAP-UHFFFAOYSA-M |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)[O-])C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C.[Na+] |
| Storage condition | -20℃ |
| Water Solubility | soluble |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R37 |
| WGK Germany | 3 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| MFCD00003671 |
| Ethanesulfonic acid, 2-[[(3α,5β,12α,20R)-3,12-dihydroxy-24-oxocholan-24-yl]amino]-, sodium salt (1:1) |
| Sodium 2-(((3α,5β,12α)-3,12-dihydroxy-24-oxocholan-24-yl)amino)ethane-1-sulphonate |
| EINECS 214-652-0 |
| Sodium 2-{[(3α,5β,12α,20R)-3,12-dihydroxy-24-oxocholan-24-yl]amino}ethanesulfonate |
| Taurodeoxycholate sodium salt |
| Sodium Taurodeoxycholate |
| Taurodeoxycholic acid sodiuM salt |
| Sodium taurodeoxycholate hydrate |