Azido-C1-PEG3-C3-NH2
Modify Date: 2025-08-27 18:58:22
Azido-C1-PEG3-C3-NH2 structure
|
Common Name | Azido-C1-PEG3-C3-NH2 | ||
|---|---|---|---|---|
| CAS Number | 1162336-72-2 | Molecular Weight | 246.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H22N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-C1-PEG3-C3-NH2Azido-C1-PEG3-C3-NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 3-(2-(2-(3-azidopropoxy)ethoxy)ethoxy)propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-C1-PEG3-C3-NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C10H22N4O3 |
|---|---|
| Molecular Weight | 246.30700 |
| Exact Mass | 246.16900 |
| PSA | 103.46000 |
| LogP | 1.23846 |
| InChIKey | VJXPLUVBIHOQFJ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCCOCCOCCOCCCN |
| Hazard Codes | Xi |
|---|
| n3-tota 1-azido-4,7,10-trioxa-13-tridecanamine |