2-chloro-3'-deoxyadenosine structure
|
Common Name | 2-chloro-3'-deoxyadenosine | ||
|---|---|---|---|---|
| CAS Number | 115044-75-2 | Molecular Weight | 285.69 | |
| Density | 2.03g/cm3 | Boiling Point | 547.6ºC at 760mmHg | |
| Molecular Formula | C10H12ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285ºC | |
Use of 2-chloro-3'-deoxyadenosine2-Chloro-3′-deoxyadenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | (2R,3R,5S)-2-(6-amino-2-chloropurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Chloro-3′-deoxyadenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.03g/cm3 |
|---|---|
| Boiling Point | 547.6ºC at 760mmHg |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.69 |
| Flash Point | 285ºC |
| Exact Mass | 285.06300 |
| PSA | 119.31000 |
| LogP | 0.28380 |
| Vapour Pressure | 7.95E-13mmHg at 25°C |
| Index of Refraction | 1.87 |
| InChIKey | HNSLUZJFGNTTEV-OBXARNEKSA-N |
| SMILES | Nc1nc(Cl)nc2c1ncn2C1OC(CO)CC1O |
| biodribin |
| C10H14ClN5O3 |
| Adenosine,2-chloro-3'-deoxy |
| 2-Chloro-3'-deoxyadenosine |
| 2-chlorocordycepin |
| 3'-Deoxy-2-chloroadenosine |
| UNII-JYW18Y92UP |