Z-DEVD-AFC
Modify Date: 2025-08-25 12:16:40
Z-DEVD-AFC structure
|
Common Name | Z-DEVD-AFC | ||
|---|---|---|---|---|
| CAS Number | 1135416-11-3 | Molecular Weight | 821.707 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 1160.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C36H38F3N5O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 655.9±34.3 °C | |
Use of Z-DEVD-AFCZ-DEVD-AFC is a cell-permeant substrate for caspase-3, which causes a shift in fluorescence uponcleavage of the AFC fluorophore. Z-DEVD-AFC can be used to detect caspase-3-like enzymes activity[1]. |
| Name | Z-DEVD-AFC |
|---|---|
| Synonym | More Synonyms |
| Description | Z-DEVD-AFC is a cell-permeant substrate for caspase-3, which causes a shift in fluorescence uponcleavage of the AFC fluorophore. Z-DEVD-AFC can be used to detect caspase-3-like enzymes activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 1160.9±65.0 °C at 760 mmHg |
| Molecular Formula | C36H38F3N5O14 |
| Molecular Weight | 821.707 |
| Flash Point | 655.9±34.3 °C |
| Exact Mass | 821.236755 |
| LogP | 4.15 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | JEPURZRNABGOCW-CQUCHYGKSA-N |
| SMILES | CC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| N-[(Benzyloxy)carbonyl]-L-α-aspartyl-L-α-glutamyl-L-valyl-N-[2-oxo-4-(trifluoromethyl)-2H-chromen-7-yl]-L-α-asparagine |
| L-α-Asparagine, N-[(phenylmethoxy)carbonyl]-L-α-aspartyl-L-α-glutamyl-L-valyl-N-[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl]- |
| Z-DEVD-AFC |