FGF22-IN-1 structure
|
Common Name | FGF22-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 113143-13-8 | Molecular Weight | 269.32 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H11N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FGF22-IN-1FGF22-IN-1 (compound c1) is a potent CD4 D1 inhibitor. FGF22-IN-1 can be used as immunosuppressive agent[1]. |
| Name | N'-(1H-indol-3-ylmethylene)-2-thiophenecarbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Description | FGF22-IN-1 (compound c1) is a potent CD4 D1 inhibitor. FGF22-IN-1 can be used as immunosuppressive agent[1]. |
|---|---|
| Related Catalog | |
| Target |
CD4 D1[1] |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.32 |
| Exact Mass | 269.062286 |
| LogP | 2.39 |
| Index of Refraction | 1.707 |
| InChIKey | FMKAYIUNMIHSEK-CXUHLZMHSA-N |
| SMILES | O=C(NN=Cc1c[nH]c2ccccc12)c1cccs1 |
| N'-[(E)-1H-Indol-3-ylmethylene]-2-thiophenecarbohydrazide |
| N'-[(E)-1H-Indol-3-ylmethylene]thiophene-2-carbohydrazide |
| 2-Thiophenecarboxylic acid, 2-[(1E)-1H-indol-3-ylmethylene]hydrazide |