Demethoxyfumitremorgin C
Modify Date: 2025-08-20 19:07:52
Demethoxyfumitremorgin C structure
|
Common Name | Demethoxyfumitremorgin C | ||
|---|---|---|---|---|
| CAS Number | 111768-16-2 | Molecular Weight | 349.43 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 617.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C21H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.4±31.5 °C | |
Use of Demethoxyfumitremorgin CDemethoxyfumitremorgin C is a secondary metabolite of the marine fungus, Aspergillus fumigatus. Demethoxyfumitremorgin C induces prostate cancer cell apoptosis. Demethoxyfumitremorgin C activates caspase-3, -8, and -9, leading to PARP/ cleavage[1]. |
| Name | demethoxyfumitremorgin C |
|---|---|
| Synonym | More Synonyms |
| Description | Demethoxyfumitremorgin C is a secondary metabolite of the marine fungus, Aspergillus fumigatus. Demethoxyfumitremorgin C induces prostate cancer cell apoptosis. Demethoxyfumitremorgin C activates caspase-3, -8, and -9, leading to PARP/ cleavage[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 617.8±55.0 °C at 760 mmHg |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 |
| Flash Point | 327.4±31.5 °C |
| Exact Mass | 349.179016 |
| LogP | 1.89 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | LQXCSIKDOISJTI-BZSNNMDCSA-N |
| SMILES | CC(C)=CC1c2[nH]c3ccccc3c2CC2C(=O)N3CCCC3C(=O)N21 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
| 5H,14H-Pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione, 1,2,3,5a,6,11,12,14a-octahydro-12-(2-methyl-1-propen-1-yl)-, (5aS,12S,14aS)- |
| demethoxyfumitremorgin C |
| (5aS,12S,14aS)-12-(2-Methyl-1-propen-1-yl)-1,2,3,5a,6,11,12,14a-octahydro-5H,14H-pyrrolo[1'',2'':4',5']pyrazino[1',2':1,6]pyrido[3,4-b]indole-5,14-dione |