Azido-PEG3-CH2CO2-NHS
Modify Date: 2025-09-23 17:30:29
Azido-PEG3-CH2CO2-NHS structure
|
Common Name | Azido-PEG3-CH2CO2-NHS | ||
|---|---|---|---|---|
| CAS Number | 1092654-47-1 | Molecular Weight | 330.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG3-CH2CO2-NHSAzido-PEG3-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG3-NHS ester |
|---|
| Description | Azido-PEG3-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H18N4O7 |
|---|---|
| Molecular Weight | 330.29 |
| InChIKey | XNHIEMNCUYXCFI-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCC(=O)ON1C(=O)CCC1=O |