PEG12-Tos
Modify Date: 2024-04-03 17:59:27
PEG12-Tos structure
|
Common Name | PEG12-Tos | ||
|---|---|---|---|---|
| CAS Number | 1050500-41-8 | Molecular Weight | 700.832 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 724.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C31H56O15S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 391.9±32.9 °C | |
Use of PEG12-TosTos-PEG12 is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
| Name | 35-Hydroxy-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG12 is a noncleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 724.4±60.0 °C at 760 mmHg |
| Molecular Formula | C31H56O15S |
| Molecular Weight | 700.832 |
| Flash Point | 391.9±32.9 °C |
| Exact Mass | 700.333984 |
| LogP | -2.99 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | CXFHSAUILDFVJJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)cc1 |
| Hazard Codes | Xi |
|---|
| 3,6,9,12,15,18,21,24,27,30,33-Undecaoxapentatriacontane-1,35-diol, mono(4-methylbenzenesulfonate) |
| 35-Hydroxy-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl 4-methylbenzenesulfonate |