Tos-PEG7-OH
Modify Date: 2025-08-26 13:29:17
Tos-PEG7-OH structure
|
Common Name | Tos-PEG7-OH | ||
|---|---|---|---|---|
| CAS Number | 1028089-05-5 | Molecular Weight | 480.569 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 554.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H36O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.1±30.1 °C | |
Use of Tos-PEG7-OHTos-PEG7-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | PEG8-Tos |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG7-OH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 554.5±50.0 °C at 760 mmHg |
| Molecular Formula | C21H36O10S |
| Molecular Weight | 480.569 |
| Flash Point | 289.1±30.1 °C |
| Exact Mass | 480.202911 |
| LogP | -1.30 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | OPGOVMSKPDWRRQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCO)cc1 |
| MFCD24539472 |
| 2,5,8,11,14,17,20-Heptaoxadocosan-22-ol, benzenesulfonate |
| 2,5,8,11,14,17,20-Heptaoxadocosan-22-yl benzenesulfonate |