ALDH3A1-IN-2 structure
|
Common Name | ALDH3A1-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 374635-48-0 | Molecular Weight | 222.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ALDH3A1-IN-2ALDH3A1-IN-2 (Compound 19) is a potent inhibitor of ALDH3A1 with an IC50 of 1.29 μM. Aldehyde dehydrogenases (ALDHs) are overexpressed in various tumor types including prostate cancer. ALDH3A1-IN-2 has the potential for the research of cancer diseases[1]. |
| Name | ALDH3A1-IN-2 |
|---|
| Description | ALDH3A1-IN-2 (Compound 19) is a potent inhibitor of ALDH3A1 with an IC50 of 1.29 μM. Aldehyde dehydrogenases (ALDHs) are overexpressed in various tumor types including prostate cancer. ALDH3A1-IN-2 has the potential for the research of cancer diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C11H14N2O3 |
|---|---|
| Molecular Weight | 222.24 |
| InChIKey | GAIBXTKNUDDQMR-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C=O)cc1[N+](=O)[O-] |