methyl 5-acetamido-2-methoxybenzoate
Modify Date: 2025-09-23 08:11:38
methyl 5-acetamido-2-methoxybenzoate structure
|
Common Name | methyl 5-acetamido-2-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 79893-19-9 | Molecular Weight | 223.22500 | |
| Density | 1.21g/cm3 | Boiling Point | 420.1ºC at 760 mmHg | |
| Molecular Formula | C11H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | methyl 5-acetamido-2-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 420.1ºC at 760 mmHg |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.22500 |
| Flash Point | 207.9ºC |
| Exact Mass | 223.08400 |
| PSA | 68.12000 |
| LogP | 2.08970 |
| Index of Refraction | 1.552 |
| InChIKey | OICCRSUCOIYODF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(NC(C)=O)ccc1OC |
|
~93%
methyl 5-acetam... CAS#:79893-19-9 |
| Literature: Zhu, Jiang; Lin, Jian-Bin; Xu, Yun-Xiang; Shao, Xue-Bin; Jiang, Xi-Kui; Li, Zhan-Ting Journal of the American Chemical Society, 2006 , vol. 128, # 37 p. 12307 - 12313 |
|
~%
methyl 5-acetam... CAS#:79893-19-9 |
| Literature: Maynard, George D.; Le, Tieu-Binh Patent: US2001/34343 A1, 2001 ; Title/Abstract Full Text Show Details Aventis Pharmaceuticals Inc. Patent: US6194406 B1, 2001 ; US 6194406 B1 |
CAS#:79893-20-2| Methyl 5-(acetylamino)-o-anisate |
| methyl 5-(acetylamino)-2-methoxybenzoate |
| methyl 2-methoxy-5-acetamidobenzoate |
| 5-Acetamino-2-methoxy-benzoesaeure-methylester |
| EINECS 279-333-0 |