methyl 5-(acetylamino)-2-methoxy-4-nitrobenzoate
Modify Date: 2025-11-19 13:19:04
methyl 5-(acetylamino)-2-methoxy-4-nitrobenzoate structure
|
Common Name | methyl 5-(acetylamino)-2-methoxy-4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 79893-20-2 | Molecular Weight | 268.22300 | |
| Density | 1.366g/cm3 | Boiling Point | 518.3ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.3ºC | |
| Name | methyl 5-acetamido-2-methoxy-4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 518.3ºC at 760 mmHg |
| Molecular Formula | C11H12N2O6 |
| Molecular Weight | 268.22300 |
| Flash Point | 267.3ºC |
| Exact Mass | 268.07000 |
| PSA | 113.94000 |
| LogP | 2.52110 |
| Index of Refraction | 1.582 |
| InChIKey | HEOLZRXLDUVPQK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(NC(C)=O)c([N+](=O)[O-])cc1OC |
|
~%
methyl 5-(acety... CAS#:79893-20-2 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GmbH; BOEHRINGER INGELHEIM PHARMA GmbH and CO KG Patent: WO2005/80388 A1, 2005 ; Location in patent: Page/Page column 68 ; WO 2005/080388 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Methyl 5-(acetylamino)-2-methoxy-4-nitrobenzoate |
| EINECS 279-334-6 |
| Benzoic acid,5-(acetylamino)-2-methoxy-4-nitro-,methyl ester |