N-(3-Aminophenyl)-2,2-dimethylpropanamide structure
|
Common Name | N-(3-Aminophenyl)-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 41402-58-8 | Molecular Weight | 192.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-Aminophenyl)-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16N2O |
|---|---|
| Molecular Weight | 192.25800 |
| Exact Mass | 192.12600 |
| PSA | 55.12000 |
| LogP | 2.90760 |
| InChIKey | SWZXCZQXUJHQJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1cccc(N)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
|
~%
N-(3-Aminopheny... CAS#:41402-58-8 |
| Literature: SCHERING AKTIENGESELLSCHAFT Patent: WO2006/82107 A1, 2006 ; Location in patent: Page/Page column 36-37 ; WO 2006/082107 A1 |
|
~63%
N-(3-Aminopheny... CAS#:41402-58-8 |
| Literature: Ueda, Satoshi; Nagasawa, Hideko Journal of Organic Chemistry, 2009 , vol. 74, # 11 p. 4272 - 4277 |
|
~%
N-(3-Aminopheny... CAS#:41402-58-8 |
| Literature: Siemeister, Gerhard; Briem, Hans; Schulze, Volker; Eis, Knut; Wortmann, Lars; Schwede, Wolfgang; Schneider, Herbert; Eberspaecher, Uwe; Hess-Stumpp, Holger Patent: US2007/37862 A1, 2007 ; US 20070037862 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-amino-2,2-dimethylpropionanilide |