p-nitrophenyl ester of benzoylaminoacetic acid structure
|
Common Name | p-nitrophenyl ester of benzoylaminoacetic acid | ||
|---|---|---|---|---|
| CAS Number | 3101-11-9 | Molecular Weight | 300.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | p-nitrophenyl ester of benzoylaminoacetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H12N2O5 |
|---|---|
| Molecular Weight | 300.26600 |
| Exact Mass | 300.07500 |
| PSA | 101.22000 |
| LogP | 2.84430 |
| InChIKey | ZPOAJFPTNSFEDJ-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)c1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-nitrophenyl hippurate |
| p-nitrophenyl N-benzoylglycinate |
| hippuric acid p-nitrophenyl ester |
| 4-nitrophenyl N-benzoylglycinate |
| Hippursaeure-4-nitrophenylester |
| N-benzoylglycine 4-nitrophenyl ester |