1-diethylphosphoryloxy-4-nitrobenzene
Modify Date: 2025-10-13 15:49:00
1-diethylphosphoryloxy-4-nitrobenzene structure
|
Common Name | 1-diethylphosphoryloxy-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 7531-39-7 | Molecular Weight | 243.19600 | |
| Density | 1.222g/cm3 | Boiling Point | 352.3ºC at 760 mmHg | |
| Molecular Formula | C10H14NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.9ºC | |
| Name | 1-diethylphosphoryloxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 352.3ºC at 760 mmHg |
| Molecular Formula | C10H14NO4P |
| Molecular Weight | 243.19600 |
| Flash Point | 166.9ºC |
| Exact Mass | 243.06600 |
| PSA | 81.93000 |
| LogP | 3.81470 |
| Index of Refraction | 1.517 |
| InChIKey | DOJNLTSZOHKYAA-UHFFFAOYSA-N |
| SMILES | CCP(=O)(CC)Oc1ccc([N+](=O)[O-])cc1 |
| para-Nitrophenyl ester of diethylphosphinic acid |
| Phosphinic acid,diethyl-,p-nitrophenyl ester |
| Diethylphosphinic acid p-nitrophenyl ester |
| 4-nitrophenyl diethylphosphinate |
| p-nitrophenyl diethylphosphinate |