1-(butoxy-ethyl-phosphoryl)oxy-4-nitro-benzene
Modify Date: 2025-08-25 23:41:35
1-(butoxy-ethyl-phosphoryl)oxy-4-nitro-benzene structure
|
Common Name | 1-(butoxy-ethyl-phosphoryl)oxy-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 71002-67-0 | Molecular Weight | 287.24900 | |
| Density | 1.205g/cm3 | Boiling Point | 395.1ºC at 760 mmHg | |
| Molecular Formula | C12H18NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.7ºC | |
| Name | 1-[butoxy(ethyl)phosphoryl]oxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 395.1ºC at 760 mmHg |
| Molecular Formula | C12H18NO5P |
| Molecular Weight | 287.24900 |
| Flash Point | 192.7ºC |
| Exact Mass | 287.09200 |
| PSA | 91.16000 |
| LogP | 4.52650 |
| Index of Refraction | 1.509 |
| InChIKey | IDBGACONKGMGDO-UHFFFAOYSA-N |
| SMILES | CCCCOP(=O)(CC)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2931900090 |
|---|
|
~%
1-(butoxy-ethyl... CAS#:71002-67-0 |
| Literature: Rasumow et al. Zhurnal Obshchei Khimii, 1957 , vol. 27, p. 2394; engl. Ausg. S. 2455 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ethyl-phosphonic acid butyl ester-(4-nitro-phenyl ester) |
| Butyl p-nitrophenyl ester of ethylphosphonic acid |
| Aethyl-phosphonsaeure-butylester-(4-nitro-phenylester) |
| 1-(BUTOXY-ETHYL-PHOSPHORYL)OXY-4-NITRO-BENZENE |
| Ethylphosphonic acid butyl p-nitrophenyl ester |
| Phosphonic acid,ethyl-,butyl p-nitrophenyl ester |
| butyl p-nitrophenyl ethylphosphonate |