Methyl 4,5,6,7-tetramethoxy-2-naphthoate structure
|
Common Name | Methyl 4,5,6,7-tetramethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 2981-92-2 | Molecular Weight | 306.31100 | |
| Density | 1.189g/cm3 | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C16H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | Methyl 4,5,6,7-tetramethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760 mmHg |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31100 |
| Flash Point | 191.6ºC |
| Exact Mass | 306.11000 |
| PSA | 63.22000 |
| LogP | 2.66080 |
| Vapour Pressure | 9.98E-08mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | MKUUUHRINZMZKK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)c(OC)c(OC)cc2c1 |
|
~%
Methyl 4,5,6,7-... CAS#:2981-92-2 |
| Literature: Bell,K.H.; Weiss,U. Australian Journal of Chemistry, 1965 , vol. 18, p. 1273 - 1277 |
| 4,5,6,7-tetraiodo-isoindoline-1,3-dione |
| tetraiodophthalimide |
| 4,5,6,7-Tetramethoxy-<2>naphthoesaeure-methylester |
| 4,5,6,7-Tetrajod-isoindolin-1,3-dion |
| methyl 4,5,6,7-tetramethoxynaphthalene-2-carboxylate |