4,5,6,7-Tetramethoxy-2-naphthoic acid
Modify Date: 2025-08-25 19:39:19
4,5,6,7-Tetramethoxy-2-naphthoic acid structure
|
Common Name | 4,5,6,7-Tetramethoxy-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 2981-93-3 | Molecular Weight | 292.28400 | |
| Density | 1.259g/cm3 | Boiling Point | 449.5ºC at 760 mmHg | |
| Molecular Formula | C15H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.2ºC | |
| Name | 4,5,6,7-Tetramethoxy-2-naphthoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 449.5ºC at 760 mmHg |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.28400 |
| Flash Point | 166.2ºC |
| Exact Mass | 292.09500 |
| PSA | 74.22000 |
| LogP | 2.57240 |
| Vapour Pressure | 7.23E-09mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | XODCCPKBMAFCKY-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C(=O)O)cc(OC)c2c(OC)c1OC |
|
~%
4,5,6,7-Tetrame... CAS#:2981-93-3 |
| Literature: Bell,K.H.; Weiss,U. Australian Journal of Chemistry, 1965 , vol. 18, p. 1273 - 1277 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| tetraiodophthalimide |
| 4,5,6,7-Tetrajod-isoindolin-1,3-dion |
| 4,5,6,7-tetraiodo-isoindoline-1,3-dione |