4,6,7-Trimethoxy-2-naphthoic acid
Modify Date: 2025-09-22 15:46:31
4,6,7-Trimethoxy-2-naphthoic acid structure
|
Common Name | 4,6,7-Trimethoxy-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 107777-62-8 | Molecular Weight | 262.25800 | |
| Density | N/A | Boiling Point | 426.1ºC at 760 mmHg | |
| Molecular Formula | C14H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.2ºC | |
| Name | 4,6,7-Trimethoxy-2-naphthoic acid |
|---|
| Boiling Point | 426.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.25800 |
| Flash Point | 161.2ºC |
| Exact Mass | 262.08400 |
| PSA | 64.99000 |
| LogP | 2.56380 |
| Vapour Pressure | 5.07E-08mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | GDRVRVMXVVEIEQ-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C(=O)O)cc(OC)c2cc1OC |
|
~%
4,6,7-Trimethox... CAS#:107777-62-8 |
| Literature: El-Assal,L.S.; El-Wahhab,S.A.M. Journal of the Chemical Society, 1960 , p. 849 - 852 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |