Methyl 4,5,6,8-tetramethoxy-2-naphthoate
Modify Date: 2025-08-24 21:56:18
Methyl 4,5,6,8-tetramethoxy-2-naphthoate structure
|
Common Name | Methyl 4,5,6,8-tetramethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 25936-88-3 | Molecular Weight | 306.31100 | |
| Density | N/A | Boiling Point | 451.6ºC at 760 mmHg | |
| Molecular Formula | C16H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | Methyl 4,5,6,8-tetramethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 451.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31100 |
| Flash Point | 200.2ºC |
| Exact Mass | 306.11000 |
| PSA | 63.22000 |
| LogP | 2.66080 |
| Vapour Pressure | 2.39E-08mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | QUSHJDWEOWYQIX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)c(OC)cc(OC)c2c1 |
|
~%
Methyl 4,5,6,8-... CAS#:25936-88-3 |
|
Literature: Harper,S.H. et al. Journal of the Chemical Society [Section] C: Organic, 1970 , vol. |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,5,6,8-Tetramethoxy-2-naphthoesaeuremethylester |