Methyl 5-hydroxy-4,6,7-trimethoxy-2-naphthoate
Modify Date: 2025-09-18 18:09:17
Methyl 5-hydroxy-4,6,7-trimethoxy-2-naphthoate structure
|
Common Name | Methyl 5-hydroxy-4,6,7-trimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 90539-45-0 | Molecular Weight | 292.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 5-hydroxy-4,6,7-trimethoxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O6 |
|---|---|
| Molecular Weight | 292.28400 |
| Exact Mass | 292.09500 |
| PSA | 74.22000 |
| LogP | 2.35780 |
| InChIKey | GUWGAEVJJNNRIT-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(O)c(OC)c(OC)cc2c1 |
|
~81%
Methyl 5-hydrox... CAS#:90539-45-0 |
| Literature: Carvalho, Christopher F.; Sargent, Melvyn V. Journal of the Chemical Society, Chemical Communications, 1984 , # 4 p. 227 - 229 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| methyl 5-hydroxy-4,6,7-trimethoxynaphthalene-2-carboxylate |