3,3-ditert-butyl-2-chlorooxaziridine
Modify Date: 2024-09-29 12:31:52
3,3-ditert-butyl-2-chlorooxaziridine structure
|
Common Name | 3,3-ditert-butyl-2-chlorooxaziridine | ||
|---|---|---|---|---|
| CAS Number | 101515-65-5 | Molecular Weight | 191.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-ditert-butyl-2-chlorooxaziridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H18ClNO |
|---|---|
| Molecular Weight | 191.69800 |
| Exact Mass | 191.10800 |
| PSA | 15.54000 |
| LogP | 3.11380 |
| InChIKey | CZKMOVWVFHPGJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1(C(C)(C)C)ON1Cl |
|
~%
3,3-ditert-buty... CAS#:101515-65-5 |
| Literature: Varlamov, S. V.; Kadorkina, G. K.; Shustov, G. V.; Chervin, I. I.; Kostyanovskii, R. G. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1985 , vol. 34, # 10 p. 2240 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1985 , # 10 p. 2416 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:101515-66-6| 2-chloro-3,3-di-tert-butyloxaziridine |
| N-chlorooxaziridine |
| 3,3-di-tert-butyl-2-chloro-oxaziridine |
| 2-chloro-3,3-di-tert-butyl-3-ethyloxaziridine |
| Oxaziridine,2-chloro-3,3-bis(1,1-dimethylethyl) |