5-Bromo-1,3-di-tert-butyl-2-methoxybenzene structure
|
Common Name | 5-Bromo-1,3-di-tert-butyl-2-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 1516-96-7 | Molecular Weight | 299.24700 | |
| Density | 1.137 | Boiling Point | 304ºC | |
| Molecular Formula | C15H23BrO | Melting Point | 49-50ºC | |
| MSDS | N/A | Flash Point | 128ºC | |
| Name | 5-Bromo-1,3-di-tert-butyl-2-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137 |
|---|---|
| Boiling Point | 304ºC |
| Melting Point | 49-50ºC |
| Molecular Formula | C15H23BrO |
| Molecular Weight | 299.24700 |
| Flash Point | 128ºC |
| Exact Mass | 298.09300 |
| PSA | 9.23000 |
| LogP | 5.05270 |
| Vapour Pressure | 0.002mmHg at 25°C |
| Index of Refraction | 1.5 |
| InChIKey | KKHJQLVAMOKQHO-UHFFFAOYSA-N |
| SMILES | COc1c(C(C)(C)C)cc(Br)cc1C(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-bromo-1,3-ditert-butyl-2-methoxybenzene |