3,5-di-tert-butyl-4-methoxytoluene structure
|
Common Name | 3,5-di-tert-butyl-4-methoxytoluene | ||
|---|---|---|---|---|
| CAS Number | 1518-53-2 | Molecular Weight | 234.37700 | |
| Density | 0.89g/cm3 | Boiling Point | 291.8ºC at 760mmHg | |
| Molecular Formula | C16H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.9ºC | |
| Name | 1,3-ditert-butyl-2-methoxy-5-methylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.89g/cm3 |
|---|---|
| Boiling Point | 291.8ºC at 760mmHg |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.37700 |
| Flash Point | 112.9ºC |
| Exact Mass | 234.19800 |
| PSA | 9.23000 |
| LogP | 4.59860 |
| Vapour Pressure | 0.00332mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | TVWAVADIILZVIY-UHFFFAOYSA-N |
| SMILES | COc1c(C(C)(C)C)cc(C)cc1C(C)(C)C |
| HS Code | 2909309090 |
|---|
|
~92%
3,5-di-tert-but... CAS#:1518-53-2 |
| Literature: Villalonga-Barber, Carolina; Meligova, Aggeliki K.; Alexi, Xanthippi; Steele, Barry R.; Kouzinos, Constantinos E.; Screttas, Constantinos G.; Katsanou, Efrosini S.; Micha-Screttas, Maria; Alexis, Michael N. Bioorganic and Medicinal Chemistry, 2011 , vol. 19, # 1 p. 339 - 351 |
|
~82%
3,5-di-tert-but... CAS#:1518-53-2 |
| Literature: Pothi, Tejas; Dawange, Mahesh; Chavan, Kamlesh; Sharma, Rajiv; Deka, Nabajyoti Journal of the Korean Chemical Society, 2012 , vol. 56, # 6 p. 706 - 711 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-di-tert-butyl-4-methyl-anisole |
| 2,6-Di-tert-butyl-4-methyl-anisol |
| 1,3-di-tert-butyl-2-methoxy-5-methylbenzene |
| Meo-bht |
| 3,5-Di-tert-butyl-4-methoxytoluene |
| QSPL 071 |