3,5-di-tert-butyl-4-hydroxybenzenepropanoyl chloride structure
|
Common Name | 3,5-di-tert-butyl-4-hydroxybenzenepropanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 3062-64-4 | Molecular Weight | 296.83200 | |
| Density | 1.063 | Boiling Point | 350.1ºC at 760 mmHg | |
| Molecular Formula | C17H25ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.5ºC | |
| Name | 3,5-di-tert-butyl-4-hydroxybenzenepropanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063 |
|---|---|
| Boiling Point | 350.1ºC at 760 mmHg |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.83200 |
| Flash Point | 165.5ºC |
| Exact Mass | 296.15400 |
| PSA | 37.30000 |
| LogP | 4.68520 |
| Index of Refraction | 1.513 |
| InChIKey | ZXUKNOGFRSOORK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CCC(=O)Cl)cc(C(C)(C)C)c1O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoyl chloride |
| 3-(3,5-di-tert.butyl-4-hydroxyphenyl)-propionic acid chloride |
| 3,5-Bis(tert-butyl)-4-hydroxybenzenepropanoyl chloride |
| 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyl chloride |
| (4-Hydroxy-3,5-di-tert.-butylphenyl)-propionsaeurechlorid |
| 3-(3,5-di-t-butyl-4-hydroxyphenyl)propionic acid chloride |