2,4-ditert-butyl-6-[3-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylpropylsulfanyl]phenol
Modify Date: 2025-09-17 11:18:15
![2,4-ditert-butyl-6-[3-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylpropylsulfanyl]phenol Structure](https://image.chemsrc.com/caspic/482/663910-61-0.png)
2,4-ditert-butyl-6-[3-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylpropylsulfanyl]phenol structure
|
Common Name | 2,4-ditert-butyl-6-[3-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylpropylsulfanyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 663910-61-0 | Molecular Weight | 516.84200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H48O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-ditert-butyl-6-[3-(3,5-ditert-butyl-2-hydroxyphenyl)sulfanylpropylsulfanyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H48O2S2 |
|---|---|
| Molecular Weight | 516.84200 |
| Exact Mass | 516.31000 |
| PSA | 91.06000 |
| LogP | 9.56230 |
| InChIKey | SJTPNHGWQINKAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(SCCCSc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
|
~28%
2,4-ditert-buty... CAS#:663910-61-0 |
| Literature: Capacchione, Carmine; Proto, Antonio; Ebeling, Henner; Muelhaupt, Rolf; Moeller, Klaus; Spaniol, Thomas P.; Okuda, Jun Journal of the American Chemical Society, 2003 , vol. 125, # 17 p. 4964 - 4965 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (HOC6H2-(t-Bu2-4,6))2(S(CH2)3S) |
| 1,5-dithiapentanediyl-bis(4,6-di-tert-butylphenol) |
| Phenol,2,2'-[1,3-propanediylbis(thio)]bis[4,6-bis(1,1-dimethylethyl) |
| 1,5-dithiapentanediyl-2,2'-bis(4,6-di-tert-butylphenol) |