1-methyl-4-(4-methylsulfonylphenoxy)benzene structure
|
Common Name | 1-methyl-4-(4-methylsulfonylphenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 99902-90-6 | Molecular Weight | 262.32400 | |
| Density | 1.202g/cm3 | Boiling Point | 417.7ºC at 760 mmHg | |
| Molecular Formula | C14H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.4ºC | |
| Name | 1-methyl-4-(4-methylsulfonylphenoxy)benzene |
|---|
| Density | 1.202g/cm3 |
|---|---|
| Boiling Point | 417.7ºC at 760 mmHg |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.32400 |
| Flash Point | 206.4ºC |
| Exact Mass | 262.06600 |
| PSA | 51.75000 |
| LogP | 4.27160 |
| Index of Refraction | 1.567 |
| InChIKey | UHJNOSYKOLRPJA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2ccc(S(C)(=O)=O)cc2)cc1 |
|
~86%
1-methyl-4-(4-m... CAS#:99902-90-6 |
| Literature: Cui, Sun-Liang; Jiang, Zhi-Yong; Wang, Yan-Guang Synlett, 2004 , # 10 p. 1829 - 1831 |
|
~%
1-methyl-4-(4-m... CAS#:99902-90-6 |
| Literature: Markley; Tong; Dulworth; Steward; Goralski; Johnston; Wood; Vinogradoff; Bargar Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 427 - 433 |