1-methyl-4-[(4-nitrophenyl)methylsulfanylsulfonyl]benzene
Modify Date: 2025-10-12 23:20:54
![1-methyl-4-[(4-nitrophenyl)methylsulfanylsulfonyl]benzene Structure](https://image.chemsrc.com/caspic/378/31378-00-4.png)
1-methyl-4-[(4-nitrophenyl)methylsulfanylsulfonyl]benzene structure
|
Common Name | 1-methyl-4-[(4-nitrophenyl)methylsulfanylsulfonyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 31378-00-4 | Molecular Weight | 323.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-[(4-nitrophenyl)methylsulfanylsulfonyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO4S2 |
|---|---|
| Molecular Weight | 323.38700 |
| Exact Mass | 323.02900 |
| PSA | 113.64000 |
| LogP | 5.12930 |
| InChIKey | PHYFKUVLMXFFMA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)SCc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-methyl-4-[(4-... CAS#:31378-00-4 |
| Literature: Loudon; Livingston Journal of the Chemical Society, 1935 , p. 896 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Nitrobenzyl-p-toluolthiolsulfonat |
| p-nitrobenzyl p-toluenethiosulfonate |