1-methyl-4-[(4-methylphenyl)sulfinylmethylsulfanyl]benzene structure
|
Common Name | 1-methyl-4-[(4-methylphenyl)sulfinylmethylsulfanyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 52317-51-8 | Molecular Weight | 276.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-[(4-methylphenyl)sulfinylmethylsulfanyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16OS2 |
|---|---|
| Molecular Weight | 276.41700 |
| Exact Mass | 276.06400 |
| PSA | 61.58000 |
| LogP | 5.02650 |
| InChIKey | PLVXKMPCUYFRHK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SCS(=O)c2ccc(C)cc2)cc1 |
|
~90%
1-methyl-4-[(4-... CAS#:52317-51-8 |
| Literature: Hajipour; Mohammadpoor Baltork; Kianfar Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1999 , vol. 38, # 5 p. 607 - 610 |
|
~75%
1-methyl-4-[(4-... CAS#:52317-51-8 |
| Literature: Hajipour, Abdol R.; Guo, Lian-Wang; Ruoho, Arnold E. Molecular Crystals and Liquid Crystals, 2006 , vol. 456, # 1 p. 85 - 93 |
|
~%
1-methyl-4-[(4-... CAS#:52317-51-8 |
| Literature: Fox, Judith M.; Morris, Clare M.; Smyth, G. Darren; Whitman, Gordon H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1994 , # 6 p. 731 - 738 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-methyl-4-[(p-tolylthio)methylsulfinyl]benzene |
| 1-methyl-4-(p-tolylsulfanyl-methylsulfinyl)-benzene |
| Benzene,1-methyl-4-[[[(4-methylphenyl)sulfinyl]methyl]thio] |