3-Bromo-1-(phenylsulfonyl)indole structure
|
Common Name | 3-Bromo-1-(phenylsulfonyl)indole | ||
|---|---|---|---|---|
| CAS Number | 99655-68-2 | Molecular Weight | 336.204 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 498.0±37.0 °C at 760 mmHg | |
| Molecular Formula | C14H10BrNO2S | Melting Point | 122-126 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 255.0±26.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Bromo-1-(phenylsulfonyl)indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.0±37.0 °C at 760 mmHg |
| Melting Point | 122-126 °C(lit.) |
| Molecular Formula | C14H10BrNO2S |
| Molecular Weight | 336.204 |
| Flash Point | 255.0±26.5 °C |
| Exact Mass | 334.961548 |
| PSA | 47.45000 |
| LogP | 4.48 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | MXPFKHHDXIJNDX-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)n1cc(Br)c2ccccc21 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R22 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~99%
3-Bromo-1-(phen... CAS#:99655-68-2 |
| Literature: Davis, Deborah A.; Gribble, Gordon W. Heterocycles, 1992 , vol. 34, # 8 p. 1613 - 1621 |
|
~%
3-Bromo-1-(phen... CAS#:99655-68-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 50, # 15 p. 3412 - 3415 |
|
~%
3-Bromo-1-(phen... CAS#:99655-68-2 |
| Literature: Tetrahedron, , vol. 62, # 14 p. 3242 - 3247 |
|
~%
3-Bromo-1-(phen... CAS#:99655-68-2 |
| Literature: Journal of Organic Chemistry, , vol. 51, # 12 p. 2343 - 2351 |
|
~%
3-Bromo-1-(phen... CAS#:99655-68-2 |
| Literature: Heterocycles, , vol. 34, # 11 p. 2095 - 2108 |
|
~%
3-Bromo-1-(phen... CAS#:99655-68-2 |
| Literature: Heterocycles, , vol. 34, # 11 p. 2095 - 2108 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Bromo-1-(phenylsulfonyl)-1H-indole |
| T56 BNJ BSWR& DE |
| 1-(benzenesulfonyl)-3-bromoindole |
| 1-(Benzenesulphonyl)-3-bromo-1H-indole |
| 3-Bromo-1-(phenylsulfonyl)indole |
| MFCD02681986 |
| 1-Benzenesulfonyl-3-bromo-1H-indole |
| 1H-Indole, 3-bromo-1-(phenylsulfonyl)- |