metaphit methanesulfonate
metaphit methanesulfonate structure
|
Common Name | metaphit methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 99287-12-4 | Molecular Weight | 396.56700 | |
| Density | N/A | Boiling Point | 433.7ºC at 760 mmHg | |
| Molecular Formula | C19H28N2O3S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 216.1ºC | |
| Name | Metaphit Methanesulfonate Salt |
|---|
| Boiling Point | 433.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H28N2O3S2 |
| Molecular Weight | 396.56700 |
| Flash Point | 216.1ºC |
| Exact Mass | 396.15400 |
| PSA | 110.44000 |
| LogP | 5.58890 |
| Appearance of Characters | solid | white |
| InChIKey | ZASHKPXYYPYQRI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.S=C=Nc1cccc(C2(N3CCCCC3)CCCCC2)c1 |
| Storage condition | −20°C |
| Stability | Hygroscopic |
| Water Solubility | H2O: soluble |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Acylation of sigma receptors by Metaphit, an isothiocyanate derivative of phencyclidine.
Eur. J. Pharmacol. 161 , 273-277, (1989) Pretreatment of guinea pig brain membranes with 1-[1-(3-isothiocyanatophenyl)cyclohexyl]piperidine (Metaphit) caused irreversible and differential inhibition of ligand binding to sigma (sigma) recepto... |
|
|
Metaphit, a proposed phencyclidine (PCP) antagonist, prevents PCP-induced locomotor behavior through mechanisms unrelated to specific blockade of PCP receptors.
Eur. J. Pharmacol. 140 , 267, (1987) Metaphit, a derivative of phencyclidine (PCP) which irreversibly binds to a population of PCP receptor sites in rat brain, has been considered as a potentially specific PCP antagonist. In whole animal... |
|
|
Long-term blockade of the dopamine uptake complex by metaphit, an isothiocyanate derivative of phencyclidine.
Synapse 3 , 239-245, (1989) [3H]Mazindol was used to label the dopamine uptake complex in mouse striatum in vitro in the presence and absence of metaphit, an isothiocyanate derivative of phencyclidine. In some experiments, metap... |