Microcystin-LA
Modify Date: 2025-08-20 06:46:16
Microcystin-LA structure
|
Common Name | Microcystin-LA | ||
|---|---|---|---|---|
| CAS Number | 96180-79-9 | Molecular Weight | 910.064 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1237.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C46H67N7O12 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 701.9±34.3 °C | |
Use of Microcystin-LAMicrocystin LA, a natural toxin, exerts its cytotoxic exects by inhibiting the serine-threonine protein phosphatases PP1 and PP2A with IC50s of 0.3 and 0.3 nM, respectively[1]. |
| Name | (5R,8S,11R,12S,15S,18S,19S,22R)-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-1,5,12,15,19-pentamethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptazacyclopentacosane-11,22-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Microcystin LA, a natural toxin, exerts its cytotoxic exects by inhibiting the serine-threonine protein phosphatases PP1 and PP2A with IC50s of 0.3 and 0.3 nM, respectively[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Microcystin LA inhibit PP1 and PP2A quite potently and specifically relative to other known phosphatases, such as PP2B (calcineurin), PP2C, and the tyrosine phosphatases[1]. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1237.0±65.0 °C at 760 mmHg |
| Molecular Formula | C46H67N7O12 |
| Molecular Weight | 910.064 |
| Flash Point | 701.9±34.3 °C |
| Exact Mass | 909.484741 |
| PSA | 299.68000 |
| LogP | -0.52 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | DIAQQISRBBDJIM-DRSCAGMXSA-N |
| SMILES | C=C1C(=O)NC(C)C(=O)NC(CC(C)C)C(=O)NC(C(=O)O)C(C)C(=O)NC(C)C(=O)NC(C=CC(C)=CC(C)C(Cc2ccccc2)OC)C(C)C(=O)NC(C(=O)O)CCC(=O)N1C |
| (5R,8S,11R,12S,15S,18S,19S,22R)-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dien-1-yl]-1,5,12,15,19-pentamethyl-2-methylidene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid |
| Toxin BE 4 |
| Cyanoginosin-LA |
| (5R,8S,11R,12S,15S,18S,19S,22R)-8-Isobutyl-18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenyl-1,3-heptadien-1-yl]-1,5,12,15,19-pentamethyl-2-methylene-3,6,9,13,16,20,25-heptaoxo-1,4,7,10,14,17,21-heptaazacyclopentacosane-11,22-dicarboxylic acid |
| 1,4,7,10,14,17,21-Heptaazacyclopentacosane-11,22-dicarboxylic acid, 18-[(1E,3E,5S,6S)-6-methoxy-3,5-dimethyl-7-phenyl-1,3-heptadien-1-yl]-1,5,12,15,19-pentamethyl-2-methylene-8-(2-methylpropyl)-3,6,9,13,16,20,25-heptaoxo-, (5R,8S,11R,12S,15S,18S,19S,22R)- |